C12H19F3N2O3 — CID 138550310
tert-butyl N-[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)pent-4-en-2-yl]carbamate (PubChem CID 138550310) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 138550310 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-(2,2,2-trifluoroethylamino)pent-4-en-2-yl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O3/c1-5-6-8(9(18)16-7-12(13,14)15)17-10(19)20-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,16,18)(H,17,19)/t8-/m0/s1 |
| InChIKey | JUYQDMWEJMNSMT-QMMMGPOBSA-N |
| XLogP | 2.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|