About (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide
(2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide (PubChem CID 138550312) has the molecular formula C8H12F3NO
and a molecular weight of 195.18 g/mol. Its IUPAC name is (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide.
Molecular Properties
| Compound Name | (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide |
| PubChem CID | 138550312 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide |
| SMILES | C=CC[C@H](C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO/c1-3-4-6(2)7(13)12-5-8(9,10)11/h3,6H,1,4-5H2,2H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | BUGLJUOFIXGUBW-LURJTMIESA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide?
The IUPAC name of (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide (CID 138550312) is (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide.
What is the SMILES notation for (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide?
The canonical SMILES for (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide is C=CC[C@H](C)C(=O)NCC(F)(F)F.
What is the InChIKey of (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide?
The InChIKey is BUGLJUOFIXGUBW-LURJTMIESA-N. The full InChI is InChI=1S/C8H12F3NO/c1-3-4-6(2)7(13)12-5-8(9,10)11/h3,6H,1,4-5H2,2H3,(H,12,13)/t6-/m0/s1.
What are the key properties of (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide?
(2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide has a molecular weight of 195.18 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-N-(2,2,2-trifluoroethyl)pent-4-enamide is sourced from PubChem (CID 138550312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).