About (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene
(1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene (PubChem CID 138550944) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 138550944 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene |
| SMILES | C=C[C@@H]1OC[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C12H14O/c1-3-12-11-7-5-4-6-10(11)9(2)8-13-12/h3-7,9,12H,1,8H2,2H3/t9-,12-/m0/s1 |
| InChIKey | RITQTDCCRNXZQK-CABZTGNLSA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene?
The IUPAC name of (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene (CID 138550944) is (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene is C=C[C@@H]1OC[C@H](C)c2ccccc21.
What is the InChIKey of (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene?
The InChIKey is RITQTDCCRNXZQK-CABZTGNLSA-N. The full InChI is InChI=1S/C12H14O/c1-3-12-11-7-5-4-6-10(11)9(2)8-13-12/h3-7,9,12H,1,8H2,2H3/t9-,12-/m0/s1.
What are the key properties of (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene?
(1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene has a molecular weight of 174.24 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-1-ethenyl-4-methyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 138550944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).