C18H24F3NO2S — CID 138550957
N-[(E)-3-cyclohexylprop-2-enyl]-1,1,1-trifluoro-N-(2-phenylethyl)methanesulfonamide (PubChem CID 138550957) has the molecular formula C18H24F3NO2S and a molecular weight of 375.46 g/mol. Its IUPAC name is N-[(E)-3-cyclohexylprop-2-enyl]-1,1,1-trifluoro-N-(2-phenylethyl)methanesulfonamide.
| Compound Name | N-[(E)-3-cyclohexylprop-2-enyl]-1,1,1-trifluoro-N-(2-phenylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 138550957 |
| Molecular Formula | C18H24F3NO2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[(E)-3-cyclohexylprop-2-enyl]-1,1,1-trifluoro-N-(2-phenylethyl)methanesulfonamide |
| SMILES | O=S(=O)(N(C/C=C/C1CCCCC1)CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO2S/c19-18(20,21)25(23,24)22(15-13-17-10-5-2-6-11-17)14-7-12-16-8-3-1-4-9-16/h2,5-7,10-12,16H,1,3-4,8-9,13-15H2/b12-7+ |
| InChIKey | AZTAWTHMLARXJM-KPKJPENVSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|