About N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide
N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide (PubChem CID 138550958) has the molecular formula C18H18F3NO2S
and a molecular weight of 369.41 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide |
| PubChem CID | 138550958 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide |
| SMILES | C/C(=C\CN(Cc1ccccc1)S(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H18F3NO2S/c1-15(17-10-6-3-7-11-17)12-13-22(25(23,24)18(19,20)21)14-16-8-4-2-5-9-16/h2-12H,13-14H2,1H3/b15-12+ |
| InChIKey | DGFXKJUSJYFWLR-NTCAYCPXSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide?
The IUPAC name of N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide (CID 138550958) is N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide.
What is the SMILES notation for N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide?
The canonical SMILES for N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide is C/C(=C\CN(Cc1ccccc1)S(=O)(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide?
The InChIKey is DGFXKJUSJYFWLR-NTCAYCPXSA-N. The full InChI is InChI=1S/C18H18F3NO2S/c1-15(17-10-6-3-7-11-17)12-13-22(25(23,24)18(19,20)21)14-16-8-4-2-5-9-16/h2-12H,13-14H2,1H3/b15-12+.
What are the key properties of N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide?
N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide has a molecular weight of 369.41 g/mol, XLogP of 4.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,1,1-trifluoro-N-[(E)-3-phenylbut-2-enyl]methanesulfonamide is sourced from PubChem (CID 138550958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).