C16H20F3NO2S — CID 138550964
N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-phenylmethanesulfonamide (PubChem CID 138550964) has the molecular formula C16H20F3NO2S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-phenylmethanesulfonamide.
| Compound Name | N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 138550964 |
| Molecular Formula | C16H20F3NO2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-phenylmethanesulfonamide |
| SMILES | O=S(=O)(N(CC=CC1CCCCC1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO2S/c17-16(18,19)23(21,22)20(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h2,5-7,10-12,14H,1,3-4,8-9,13H2 |
| InChIKey | ZSRHBXGAKWENAX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|