C36H19F2NO2S — CID 138551655
2-[[5-[4-fluoro-8-(4-fluorophenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 138551655) has the molecular formula C36H19F2NO2S and a molecular weight of 567.62 g/mol. Its IUPAC name is 2-[[5-[4-fluoro-8-(4-fluorophenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-[4-fluoro-8-(4-fluorophenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 138551655 |
| Molecular Formula | C36H19F2NO2S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 2-[[5-[4-fluoro-8-(4-fluorophenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(-c3ccc4c5c(cccc35)-c3cc(F)ccc3N4c3ccc(F)cc3)s2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C36H19F2NO2S/c37-20-8-11-22(12-9-20)39-31-15-10-21(38)18-29(31)26-7-3-6-25-24(14-16-32(39)34(25)26)33-17-13-23(42-33)19-30-35(40)27-4-1-2-5-28(27)36(30)41/h1-19H |
| InChIKey | LIKUXABMYAGMFF-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|