About propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate
propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate (PubChem CID 138551994) has the molecular formula C8H15F2NO2
and a molecular weight of 195.21 g/mol. Its IUPAC name is propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate |
| PubChem CID | 138551994 |
| Molecular Formula | C8H15F2NO2 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate |
| SMILES | CC(C)OC(=O)NC(C)(C)C(F)F |
| InChI | InChI=1S/C8H15F2NO2/c1-5(2)13-7(12)11-8(3,4)6(9)10/h5-6H,1-4H3,(H,11,12) |
| InChIKey | KTVSGJBCCCUVAN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate?
The IUPAC name of propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate (CID 138551994) is propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate.
What is the SMILES notation for propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate?
The canonical SMILES for propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate is CC(C)OC(=O)NC(C)(C)C(F)F.
What is the InChIKey of propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate?
The InChIKey is KTVSGJBCCCUVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO2/c1-5(2)13-7(12)11-8(3,4)6(9)10/h5-6H,1-4H3,(H,11,12).
What are the key properties of propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate?
propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate has a molecular weight of 195.21 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(1,1-difluoro-2-methylpropan-2-yl)carbamate is sourced from PubChem (CID 138551994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).