C31H20N4O — CID 138552145
2-[[2-[8-(4-ethylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]-1,3-oxazol-5-yl]methylidene]propanedinitrile (PubChem CID 138552145) has the molecular formula C31H20N4O and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[[2-[8-(4-ethylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]-1,3-oxazol-5-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[2-[8-(4-ethylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]-1,3-oxazol-5-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 138552145 |
| Molecular Formula | C31H20N4O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[[2-[8-(4-ethylphenyl)-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]-1,3-oxazol-5-yl]methylidene]propanedinitrile |
| SMILES | CCc1ccc(N2c3ccccc3-c3cccc4c(-c5ncc(C=C(C#N)C#N)o5)ccc2c34)cc1 |
| InChI | InChI=1S/C31H20N4O/c1-2-20-10-12-22(13-11-20)35-28-9-4-3-6-24(28)25-7-5-8-26-27(14-15-29(35)30(25)26)31-34-19-23(36-31)16-21(17-32)18-33/h3-16,19H,2H2,1H3 |
| InChIKey | MCBBITXDHMOXAK-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 76.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|