C39H25N3O2S2 — CID 138552157
2-[[5-[8-(4-propan-2-ylphenyl)-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thieno[3,2-b]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 138552157) has the molecular formula C39H25N3O2S2 and a molecular weight of 631.78 g/mol. Its IUPAC name is 2-[[5-[8-(4-propan-2-ylphenyl)-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thieno[3,2-b]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-[8-(4-propan-2-ylphenyl)-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thieno[3,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 138552157 |
| Molecular Formula | C39H25N3O2S2 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | 2-[[5-[8-(4-propan-2-ylphenyl)-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl]thieno[3,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC(C)c1ccc(N2c3cncnc3-c3cccc4c(-c5cc6sc(C=C7C(=O)c8ccccc8C7=O)cc6s5)ccc2c34)cc1 |
| InChI | InChI=1S/C39H25N3O2S2/c1-21(2)22-10-12-23(13-11-22)42-31-15-14-25(26-8-5-9-29(36(26)31)37-32(42)19-40-20-41-37)33-18-35-34(46-33)17-24(45-35)16-30-38(43)27-6-3-4-7-28(27)39(30)44/h3-21H,1-2H3 |
| InChIKey | CLXDIJHCGUDSNO-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|