About 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine
4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (PubChem CID 138552371) has the molecular formula C9H15F3N4
and a molecular weight of 236.24 g/mol. Its IUPAC name is 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
Molecular Properties
| Compound Name | 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| PubChem CID | 138552371 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CN(C(C)C)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C9H15F3N4/c1-6(2)15-3-4-16(7(13)5-15)8(14)9(10,11)12/h6,13-14H,3-5H2,1-2H3/b13-7+,14-8+ |
| InChIKey | VZMXDGLHWGKSNN-FNCQTZNRSA-N |
| XLogP | 1.53 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The IUPAC name of 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (CID 138552371) is 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
What is the SMILES notation for 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The canonical SMILES for 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine is [H]/N=C1\CN(C(C)C)CCN1/C(=N/[H])C(F)(F)F.
What is the InChIKey of 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
The InChIKey is VZMXDGLHWGKSNN-FNCQTZNRSA-N. The full InChI is InChI=1S/C9H15F3N4/c1-6(2)15-3-4-16(7(13)5-15)8(14)9(10,11)12/h6,13-14H,3-5H2,1-2H3/b13-7+,14-8+.
What are the key properties of 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine?
4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine has a molecular weight of 236.24 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine is sourced from PubChem (CID 138552371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).