About propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate
propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate (PubChem CID 138552481) has the molecular formula C18H27N5O2
and a molecular weight of 345.45 g/mol. Its IUPAC name is propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate |
| PubChem CID | 138552481 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate |
| SMILES | CC(C)OC(=O)C(N)(CC(C)(C)C)c1ccc(-c2nnnn2C)cc1 |
| InChI | InChI=1S/C18H27N5O2/c1-12(2)25-16(24)18(19,11-17(3,4)5)14-9-7-13(8-10-14)15-20-21-22-23(15)6/h7-10,12H,11,19H2,1-6H3 |
| InChIKey | HHTURBOUSJLBSC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate?
The IUPAC name of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate (CID 138552481) is propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate.
What is the SMILES notation for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate?
The canonical SMILES for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate is CC(C)OC(=O)C(N)(CC(C)(C)C)c1ccc(-c2nnnn2C)cc1.
What is the InChIKey of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate?
The InChIKey is HHTURBOUSJLBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O2/c1-12(2)25-16(24)18(19,11-17(3,4)5)14-9-7-13(8-10-14)15-20-21-22-23(15)6/h7-10,12H,11,19H2,1-6H3.
What are the key properties of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate?
propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate has a molecular weight of 345.45 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(1-methyltetrazol-5-yl)phenyl]pentanoate is sourced from PubChem (CID 138552481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).