About 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol
1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol (PubChem CID 138552918) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol.
Molecular Properties
| Compound Name | 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol |
| PubChem CID | 138552918 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol |
| SMILES | CCC(S)N1CCC[C@H]1C1=CCN(C)CC1 |
| InChI | InChI=1S/C13H24N2S/c1-3-13(16)15-8-4-5-12(15)11-6-9-14(2)10-7-11/h6,12-13,16H,3-5,7-10H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | GUXIVJJFUSRDHN-UEWDXFNNSA-N |
| XLogP | 2.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol?
The IUPAC name of 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol (CID 138552918) is 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol.
What is the SMILES notation for 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol?
The canonical SMILES for 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol is CCC(S)N1CCC[C@H]1C1=CCN(C)CC1.
What is the InChIKey of 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol?
The InChIKey is GUXIVJJFUSRDHN-UEWDXFNNSA-N. The full InChI is InChI=1S/C13H24N2S/c1-3-13(16)15-8-4-5-12(15)11-6-9-14(2)10-7-11/h6,12-13,16H,3-5,7-10H2,1-2H3/t12-,13?/m0/s1.
What are the key properties of 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol?
1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol has a molecular weight of 240.42 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidin-1-yl]propane-1-thiol is sourced from PubChem (CID 138552918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).