C20H23ClIN3O3S — CID 138553274
[6-(2-chloro-3-methoxyphenyl)sulfanyl-3-[(3S)-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol (PubChem CID 138553274) has the molecular formula C20H23ClIN3O3S and a molecular weight of 547.85 g/mol. Its IUPAC name is [6-(2-chloro-3-methoxyphenyl)sulfanyl-3-[(3S)-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol.
| Compound Name | [6-(2-chloro-3-methoxyphenyl)sulfanyl-3-[(3S)-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 138553274 |
| Molecular Formula | C20H23ClIN3O3S |
| Molecular Weight | 547.85 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | [6-(2-chloro-3-methoxyphenyl)sulfanyl-3-[(3S)-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanol |
| SMILES | COc1cccc(Sc2cnc(N3CCC4(CC3)CO[C@@H](I)C4)c(CO)n2)c1Cl |
| InChI | InChI=1S/C20H23ClIN3O3S/c1-27-14-3-2-4-15(18(14)21)29-17-10-23-19(13(11-26)24-17)25-7-5-20(6-8-25)9-16(22)28-12-20/h2-4,10,16,26H,5-9,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | PNTPXOFXMPDBFL-MRXNPFEDSA-N |
| XLogP | 4.55 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|