About 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene
6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene (PubChem CID 138553425) has the molecular formula C11H13F
and a molecular weight of 164.22 g/mol. Its IUPAC name is 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene.
Molecular Properties
| Compound Name | 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene |
| PubChem CID | 138553425 |
| Molecular Formula | C11H13F |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene |
| SMILES | C=C1CCC2=C1CCC(F)=C2C |
| InChI | InChI=1S/C11H13F/c1-7-3-4-10-8(2)11(12)6-5-9(7)10/h1,3-6H2,2H3 |
| InChIKey | AGXNCQZPAUMTHH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene?
The IUPAC name of 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene (CID 138553425) is 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene.
What is the SMILES notation for 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene?
The canonical SMILES for 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene is C=C1CCC2=C1CCC(F)=C2C.
What is the InChIKey of 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene?
The InChIKey is AGXNCQZPAUMTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F/c1-7-3-4-10-8(2)11(12)6-5-9(7)10/h1,3-6H2,2H3.
What are the key properties of 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene?
6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene has a molecular weight of 164.22 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-methyl-3-methylidene-1,2,4,5-tetrahydroindene is sourced from PubChem (CID 138553425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).