C19H18FN3OS — CID 138553552
7-fluoro-2-[(4-methylphenyl)sulfanyloxymethyl]-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138553552) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is 7-fluoro-2-[(4-methylphenyl)sulfanyloxymethyl]-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 7-fluoro-2-[(4-methylphenyl)sulfanyloxymethyl]-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138553552 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 7-fluoro-2-[(4-methylphenyl)sulfanyloxymethyl]-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | Cc1ccc(SOCc2nc3n(n2)C(c2ccccc2)CC3F)cc1 |
| InChI | InChI=1S/C19H18FN3OS/c1-13-7-9-15(10-8-13)25-24-12-18-21-19-16(20)11-17(23(19)22-18)14-5-3-2-4-6-14/h2-10,16-17H,11-12H2,1H3 |
| InChIKey | CIBICYIKYFKMAN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|