C13H17N — CID 138553639
1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)aziridine (PubChem CID 138553639) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)aziridine.
| Compound Name | 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)aziridine |
|---|---|
| PubChem CID | 138553639 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)aziridine |
| SMILES | Cc1ccc2c(c1)CCC(N1CC1)C2 |
| InChI | InChI=1S/C13H17N/c1-10-2-3-12-9-13(14-6-7-14)5-4-11(12)8-10/h2-3,8,13H,4-7,9H2,1H3 |
| InChIKey | IMUCRWDBENTJCE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|