C11H11BrClN3 — CID 138553756
(5S,7S)-2-bromo-7-chloro-5-cyclohexa-2,4-dien-1-yl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138553756) has the molecular formula C11H11BrClN3 and a molecular weight of 300.59 g/mol. Its IUPAC name is (5S,7S)-2-bromo-7-chloro-5-cyclohexa-2,4-dien-1-yl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-bromo-7-chloro-5-cyclohexa-2,4-dien-1-yl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138553756 |
| Molecular Formula | C11H11BrClN3 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | (5S,7S)-2-bromo-7-chloro-5-cyclohexa-2,4-dien-1-yl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | Cl[C@H]1C[C@@H](C2C=CC=CC2)n2nc(Br)nc21 |
| InChI | InChI=1S/C11H11BrClN3/c12-11-14-10-8(13)6-9(16(10)15-11)7-4-2-1-3-5-7/h1-4,7-9H,5-6H2/t7?,8-,9-/m0/s1 |
| InChIKey | JIONJCYKHZPAGY-NPPUSCPJSA-N |
| XLogP | 3.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|