C21H19F6IO9S — CID 138553850
3,3,3-trifluoro-2-[[4-iodo-3-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyphenyl]methoxymethoxy]-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 138553850) has the molecular formula C21H19F6IO9S and a molecular weight of 688.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[4-iodo-3-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyphenyl]methoxymethoxy]-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[[4-iodo-3-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyphenyl]methoxymethoxy]-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 138553850 |
| Molecular Formula | C21H19F6IO9S |
| Molecular Weight | 688.33 g/mol |
| Exact Mass | 687.97 |
| IUPAC Name | 3,3,3-trifluoro-2-[[4-iodo-3-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxyphenyl]methoxymethoxy]-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | O=C(Oc1cc(COCOC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)ccc1I)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C21H19F6IO9S/c22-20(23,24)19(21(25,26)27,7-38(31,32)33)35-8-34-6-9-1-2-12(28)14(3-9)37-17(29)15-10-4-11-13(5-10)36-18(30)16(11)15/h1-3,10-11,13,15-16H,4-8H2,(H,31,32,33) |
| InChIKey | OMNHDNKWRYCNKJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|