About 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane]
6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] (PubChem CID 138553902) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane].
Molecular Properties
| Compound Name | 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] |
| PubChem CID | 138553902 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] |
| SMILES | CCc1ccc2c(c1)CCNC21CC1 |
| InChI | InChI=1S/C13H17N/c1-2-10-3-4-12-11(9-10)5-8-14-13(12)6-7-13/h3-4,9,14H,2,5-8H2,1H3 |
| InChIKey | UFHLBUGVZSOMTD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane]?
The IUPAC name of 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] (CID 138553902) is 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane].
What is the SMILES notation for 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane]?
The canonical SMILES for 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] is CCc1ccc2c(c1)CCNC21CC1.
What is the InChIKey of 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane]?
The InChIKey is UFHLBUGVZSOMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-2-10-3-4-12-11(9-10)5-8-14-13(12)6-7-13/h3-4,9,14H,2,5-8H2,1H3.
What are the key properties of 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane]?
6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] has a molecular weight of 187.29 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylspiro[3,4-dihydro-2H-isoquinoline-1,1'-cyclopropane] is sourced from PubChem (CID 138553902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).