C11H15NO — CID 138554110
2,7-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 138554110) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,7-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | 2,7-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 138554110 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2,7-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | Cc1ccc2c(c1)CN(C)CC2O |
| InChI | InChI=1S/C11H15NO/c1-8-3-4-10-9(5-8)6-12(2)7-11(10)13/h3-5,11,13H,6-7H2,1-2H3 |
| InChIKey | MYMQCADFWFXHBP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |