C21H37N — CID 138554241
N-[(1Z)-buta-1,3-dienyl]-4-hexylundec-1-en-3-imine (PubChem CID 138554241) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-4-hexylundec-1-en-3-imine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-4-hexylundec-1-en-3-imine |
|---|---|
| PubChem CID | 138554241 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-4-hexylundec-1-en-3-imine |
| SMILES | C=C/C=C\N=C(/C=C)C(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C21H37N/c1-5-9-12-14-16-18-20(17-15-13-10-6-2)21(8-4)22-19-11-7-3/h7-8,11,19-20H,3-6,9-10,12-18H2,1-2H3/b19-11-,22-21+ |
| InChIKey | HUOWTFMMCCXLKM-HEIFMEGOSA-N |
| XLogP | 7.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|