C21H18F3N3O3 — CID 138555116
1-(2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 138555116) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 1-(2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-(2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 138555116 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-(2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl)-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | Fc1cc(-c2cn(C3CCOC4COC(c5ccccc5)OC43)nn2)cc(F)c1F |
| InChI | InChI=1S/C21H18F3N3O3/c22-14-8-13(9-15(23)19(14)24)16-10-27(26-25-16)17-6-7-28-18-11-29-21(30-20(17)18)12-4-2-1-3-5-12/h1-5,8-10,17-18,20-21H,6-7,11H2 |
| InChIKey | TVMPLTGNYSGOFT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|