C61H42F3N11 — CID 138555515
9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 138555515) has the molecular formula C61H42F3N11 and a molecular weight of 986.08 g/mol. Its IUPAC name is 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 138555515 |
| Molecular Formula | C61H42F3N11 |
| Molecular Weight | 986.08 g/mol |
| Exact Mass | 985.36 |
| IUPAC Name | 9-[2,6-bis(2,6-diphenylpyrimidin-4-yl)-4-(trifluoromethyl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2c(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc(C(F)(F)F)cc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C61H42F3N11/c1-35-65-36(2)68-59(67-35)43-25-27-54-46(29-43)47-30-44(60-69-37(3)66-38(4)70-60)26-28-55(47)75(54)56-48(52-33-50(39-17-9-5-10-18-39)71-57(73-52)41-21-13-7-14-22-41)31-45(61(62,63)64)32-49(56)53-34-51(40-19-11-6-12-20-40)72-58(74-53)42-23-15-8-16-24-42/h5-34H,1-4H3 |
| InChIKey | GOCBCAHOFNKYNW-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.08 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |