About 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile
3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile (PubChem CID 138555541) has the molecular formula C39H24FN5
and a molecular weight of 581.65 g/mol. Its IUPAC name is 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile |
| PubChem CID | 138555541 |
| Molecular Formula | C39H24FN5 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile |
| SMILES | N#Cc1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(F)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C39H24FN5/c40-37-31(38-42-33(27-13-5-1-6-14-27)23-34(43-38)28-15-7-2-8-16-28)21-26(25-41)22-32(37)39-44-35(29-17-9-3-10-18-29)24-36(45-39)30-19-11-4-12-20-30/h1-24H |
| InChIKey | YLDVEPIIEZTCGJ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile?
The IUPAC name of 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile (CID 138555541) is 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile.
What is the SMILES notation for 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile?
The canonical SMILES for 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile is N#Cc1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(F)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1.
What is the InChIKey of 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile?
The InChIKey is YLDVEPIIEZTCGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H24FN5/c40-37-31(38-42-33(27-13-5-1-6-14-27)23-34(43-38)28-15-7-2-8-16-28)21-26(25-41)22-32(37)39-44-35(29-17-9-3-10-18-29)24-36(45-39)30-19-11-4-12-20-30/h1-24H.
What are the key properties of 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile?
3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile has a molecular weight of 581.65 g/mol, XLogP of 9.28, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4,6-diphenylpyrimidin-2-yl)-4-fluorobenzonitrile is sourced from PubChem (CID 138555541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).