C37H36N3O5P — CID 138555911
dibenzyl [2-methyl-4-[4-(4-oxo-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]butan-2-yl] phosphite (PubChem CID 138555911) has the molecular formula C37H36N3O5P and a molecular weight of 633.69 g/mol. Its IUPAC name is dibenzyl [2-methyl-4-[4-(4-oxo-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]butan-2-yl] phosphite.
| Compound Name | dibenzyl [2-methyl-4-[4-(4-oxo-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]butan-2-yl] phosphite |
|---|---|
| PubChem CID | 138555911 |
| Molecular Formula | C37H36N3O5P |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | dibenzyl [2-methyl-4-[4-(4-oxo-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]butan-2-yl] phosphite |
| SMILES | CC(C)(CCOc1ccc(-c2cn(-c3ccccc3)c3nc[nH]c(=O)c23)cc1)OP(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H36N3O5P/c1-37(2,45-46(43-25-28-12-6-3-7-13-28)44-26-29-14-8-4-9-15-29)22-23-42-32-20-18-30(19-21-32)33-24-40(31-16-10-5-11-17-31)35-34(33)36(41)39-27-38-35/h3-21,24,27H,22-23,25-26H2,1-2H3,(H,38,39,41) |
| InChIKey | KPNREPAQVHRBEV-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|