C36H36F3N9O — CID 138556215
4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-[2-[8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide (PubChem CID 138556215) has the molecular formula C36H36F3N9O and a molecular weight of 667.74 g/mol. Its IUPAC name is 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-[2-[8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide.
| Compound Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-[2-[8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 138556215 |
| Molecular Formula | C36H36F3N9O |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | 4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-[2-[8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-ylamino)imidazo[1,2-a]pyridin-3-yl]ethynyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2c(Nc3cc4n(n3)CCNC4)cccn12 |
| InChI | InChI=1S/C36H36F3N9O/c1-24-5-6-26(35(49)42-28-9-7-27(31(19-28)36(37,38)39)23-46-16-14-45(2)15-17-46)18-25(24)8-10-29-22-41-34-32(4-3-12-47(29)34)43-33-20-30-21-40-11-13-48(30)44-33/h3-7,9,12,18-20,22,40H,11,13-17,21,23H2,1-2H3,(H,42,49)(H,43,44) |
| InChIKey | ONVNXVQKIPOSBC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|