C12H16N2O8 — CID 138557086
(2,5-dioxopyrrolidin-1-yl) acetate;ethane-1,2-diol;pyrrole-2,5-dione (PubChem CID 138557086) has the molecular formula C12H16N2O8 and a molecular weight of 316.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;ethane-1,2-diol;pyrrole-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane-1,2-diol;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 138557086 |
| Molecular Formula | C12H16N2O8 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;ethane-1,2-diol;pyrrole-2,5-dione |
| SMILES | CC(=O)ON1C(=O)CCC1=O.O=C1C=CC(=O)N1.OCCO |
| InChI | InChI=1S/C6H7NO4.C4H3NO2.C2H6O2/c1-4(8)11-7-5(9)2-3-6(7)10;6-3-1-2-4(7)5-3;3-1-2-4/h2-3H2,1H3;1-2H,(H,5,6,7);3-4H,1-2H2 |
| InChIKey | KRWXKLVWQWYWBZ-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|