About methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate
methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 138558161) has the molecular formula C9H12F3NO4
and a molecular weight of 255.19 g/mol. Its IUPAC name is methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| PubChem CID | 138558161 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | C=CCOCC(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H12F3NO4/c1-3-4-17-5-6(7(14)16-2)13-8(15)9(10,11)12/h3,6H,1,4-5H2,2H3,(H,13,15) |
| InChIKey | HOWLFXHWJJAZOK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The IUPAC name of methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CID 138558161) is methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
What is the SMILES notation for methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The canonical SMILES for methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate is C=CCOCC(NC(=O)C(F)(F)F)C(=O)OC.
What is the InChIKey of methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
The InChIKey is HOWLFXHWJJAZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO4/c1-3-4-17-5-6(7(14)16-2)13-8(15)9(10,11)12/h3,6H,1,4-5H2,2H3,(H,13,15).
What are the key properties of methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate?
methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate has a molecular weight of 255.19 g/mol, XLogP of 0.41, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoate is sourced from PubChem (CID 138558161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).