About 1-hexadecan-2-yl-2,5-dihydrotetrazole
1-hexadecan-2-yl-2,5-dihydrotetrazole (PubChem CID 138558351) has the molecular formula C17H36N4
and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-hexadecan-2-yl-2,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 1-hexadecan-2-yl-2,5-dihydrotetrazole |
| PubChem CID | 138558351 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | 1-hexadecan-2-yl-2,5-dihydrotetrazole |
| SMILES | CCCCCCCCCCCCCCC(C)N1CN=NN1 |
| InChI | InChI=1S/C17H36N4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(2)21-16-18-19-20-21/h17H,3-16H2,1-2H3,(H,18,20) |
| InChIKey | XJSNGGMGWBEZDR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexadecan-2-yl-2,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexadecan-2-yl-2,5-dihydrotetrazole?
The IUPAC name of 1-hexadecan-2-yl-2,5-dihydrotetrazole (CID 138558351) is 1-hexadecan-2-yl-2,5-dihydrotetrazole.
What is the SMILES notation for 1-hexadecan-2-yl-2,5-dihydrotetrazole?
The canonical SMILES for 1-hexadecan-2-yl-2,5-dihydrotetrazole is CCCCCCCCCCCCCCC(C)N1CN=NN1.
What is the InChIKey of 1-hexadecan-2-yl-2,5-dihydrotetrazole?
The InChIKey is XJSNGGMGWBEZDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(2)21-16-18-19-20-21/h17H,3-16H2,1-2H3,(H,18,20).
What are the key properties of 1-hexadecan-2-yl-2,5-dihydrotetrazole?
1-hexadecan-2-yl-2,5-dihydrotetrazole has a molecular weight of 296.50 g/mol, XLogP of 5.61, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexadecan-2-yl-2,5-dihydrotetrazole is sourced from PubChem (CID 138558351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).