C9H16F9N2P — CID 138559431
[(2E)-2-(dimethylaminomethylidene)-4,4,4-trifluorobutylidene]-dimethylazanium hexafluorophosphate (PubChem CID 138559431) has the molecular formula C9H16F9N2P and a molecular weight of 354.20 g/mol. Its IUPAC name is [(2E)-2-(dimethylaminomethylidene)-4,4,4-trifluorobutylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [(2E)-2-(dimethylaminomethylidene)-4,4,4-trifluorobutylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 138559431 |
| Molecular Formula | C9H16F9N2P |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(2E)-2-(dimethylaminomethylidene)-4,4,4-trifluorobutylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CN(C)/C=C(/C=[N+](C)C)CC(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C9H16F3N2.F6P/c1-13(2)6-8(7-14(3)4)5-9(10,11)12;1-7(2,3,4,5)6/h6-7H,5H2,1-4H3;/q+1;-1 |
| InChIKey | DAQSHLMEYAKWCV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|