C20H16F6N6O — CID 138562149
2-[3-[8-amino-6-(2-methylpyrazol-3-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 138562149) has the molecular formula C20H16F6N6O and a molecular weight of 470.38 g/mol. Its IUPAC name is 2-[3-[8-amino-6-(2-methylpyrazol-3-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[8-amino-6-(2-methylpyrazol-3-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 138562149 |
| Molecular Formula | C20H16F6N6O |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[3-[8-amino-6-(2-methylpyrazol-3-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1-c1cnc2c(N)nc(-c3ccnn3C)cn12 |
| InChI | InChI=1S/C20H16F6N6O/c1-10-3-4-11(18(33,19(21,22)23)20(24,25)26)7-12(10)15-8-28-17-16(27)30-13(9-32(15)17)14-5-6-29-31(14)2/h3-9,33H,1-2H3,(H2,27,30) |
| InChIKey | GOKAHGXUXLHNAM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |