C16H13F6N5O — CID 138562240
2-[3-[4-amino-2-(trifluoromethyl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 138562240) has the molecular formula C16H13F6N5O and a molecular weight of 405.30 g/mol. Its IUPAC name is 2-[3-[4-amino-2-(trifluoromethyl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[3-[4-amino-2-(trifluoromethyl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 138562240 |
| Molecular Formula | C16H13F6N5O |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[3-[4-amino-2-(trifluoromethyl)imidazo[2,1-f][1,2,4]triazin-7-yl]-4-methylphenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1ccc(C(C)(O)C(F)(F)F)cc1-c1cnc2c(N)nc(C(F)(F)F)nn12 |
| InChI | InChI=1S/C16H13F6N5O/c1-7-3-4-8(14(2,28)16(20,21)22)5-9(7)10-6-24-12-11(23)25-13(15(17,18)19)26-27(10)12/h3-6,28H,1-2H3,(H2,23,25,26) |
| InChIKey | BJNJKYWCLKUSIE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |