C21H21F6N5O2 — CID 138562354
3-[3-[8-amino-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-4,4,4-trifluoro-3-hydroxy-N,2,2-trimethylbutanamide (PubChem CID 138562354) has the molecular formula C21H21F6N5O2 and a molecular weight of 489.42 g/mol. Its IUPAC name is 3-[3-[8-amino-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-4,4,4-trifluoro-3-hydroxy-N,2,2-trimethylbutanamide.
| Compound Name | 3-[3-[8-amino-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-4,4,4-trifluoro-3-hydroxy-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 138562354 |
| Molecular Formula | C21H21F6N5O2 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 3-[3-[8-amino-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-4,4,4-trifluoro-3-hydroxy-N,2,2-trimethylbutanamide |
| SMILES | CNC(=O)C(C)(C)C(O)(c1ccc(C)c(-c2cnc3c(N)nc(C(F)(F)F)cn23)c1)C(F)(F)F |
| InChI | InChI=1S/C21H21F6N5O2/c1-10-5-6-11(19(34,21(25,26)27)18(2,3)17(33)29-4)7-12(10)13-8-30-16-15(28)31-14(9-32(13)16)20(22,23)24/h5-9,34H,1-4H3,(H2,28,31)(H,29,33) |
| InChIKey | LAFXZKRNVAFLJU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |