C20H16N4O3S — CID 138562360
2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-3-phenylpropanamide (PubChem CID 138562360) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-3-phenylpropanamide.
| Compound Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 138562360 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-3-phenylpropanamide |
| SMILES | NC(=O)C(Cc1ccccc1)Sc1nnc(-c2ccco2)c(-c2ccco2)n1 |
| InChI | InChI=1S/C20H16N4O3S/c21-19(25)16(12-13-6-2-1-3-7-13)28-20-22-17(14-8-4-10-26-14)18(23-24-20)15-9-5-11-27-15/h1-11,16H,12H2,(H2,21,25) |
| InChIKey | OROFWNHFKDJQSQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |