C16H15F4N5O — CID 138562650
2-[3-(4-amino-2-methylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methylphenyl]-1,1,3,3-tetrafluoropropan-2-ol (PubChem CID 138562650) has the molecular formula C16H15F4N5O and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-[3-(4-amino-2-methylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methylphenyl]-1,1,3,3-tetrafluoropropan-2-ol.
| Compound Name | 2-[3-(4-amino-2-methylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methylphenyl]-1,1,3,3-tetrafluoropropan-2-ol |
|---|---|
| PubChem CID | 138562650 |
| Molecular Formula | C16H15F4N5O |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[3-(4-amino-2-methylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methylphenyl]-1,1,3,3-tetrafluoropropan-2-ol |
| SMILES | Cc1nc(N)c2ncc(-c3cc(C(O)(C(F)F)C(F)F)ccc3C)n2n1 |
| InChI | InChI=1S/C16H15F4N5O/c1-7-3-4-9(16(26,14(17)18)15(19)20)5-10(7)11-6-22-13-12(21)23-8(2)24-25(11)13/h3-6,14-15,26H,1-2H3,(H2,21,23,24) |
| InChIKey | JALOPYVZEQSWHY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |