About 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine
1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine (PubChem CID 138562974) has the molecular formula C18H35FN2
and a molecular weight of 298.49 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine |
| PubChem CID | 138562974 |
| Molecular Formula | C18H35FN2 |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine |
| SMILES | CC1CC(CC(C)(C)N2CCC(F)C2)C(C)N1C(C)(C)C |
| InChI | InChI=1S/C18H35FN2/c1-13-10-15(14(2)21(13)17(3,4)5)11-18(6,7)20-9-8-16(19)12-20/h13-16H,8-12H2,1-7H3 |
| InChIKey | PNPDEFNXMKQTOY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine?
The IUPAC name of 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine (CID 138562974) is 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine.
What is the SMILES notation for 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine?
The canonical SMILES for 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine is CC1CC(CC(C)(C)N2CCC(F)C2)C(C)N1C(C)(C)C.
What is the InChIKey of 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine?
The InChIKey is PNPDEFNXMKQTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35FN2/c1-13-10-15(14(2)21(13)17(3,4)5)11-18(6,7)20-9-8-16(19)12-20/h13-16H,8-12H2,1-7H3.
What are the key properties of 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine?
1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine has a molecular weight of 298.49 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[2-(3-fluoropyrrolidin-1-yl)-2-methylpropyl]-2,5-dimethylpyrrolidine is sourced from PubChem (CID 138562974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).