C20H25F3O6S — CID 138563730
5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[[(R)-[4-(trifluoromethyl)phenyl]sulfinyl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 138563730) has the molecular formula C20H25F3O6S and a molecular weight of 450.48 g/mol. Its IUPAC name is 5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[[(R)-[4-(trifluoromethyl)phenyl]sulfinyl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | 5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[[(R)-[4-(trifluoromethyl)phenyl]sulfinyl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 138563730 |
| Molecular Formula | C20H25F3O6S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[[(R)-[4-(trifluoromethyl)phenyl]sulfinyl]methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)OC2OC([C@H]3COC(C)(C)O3)C(C[S@@](=O)c3ccc(C(F)(F)F)cc3)C2O1 |
| InChI | InChI=1S/C20H25F3O6S/c1-18(2)25-9-14(27-18)15-13(16-17(26-15)29-19(3,4)28-16)10-30(24)12-7-5-11(6-8-12)20(21,22)23/h5-8,13-17H,9-10H2,1-4H3/t13?,14-,15?,16?,17?,30-/m1/s1 |
| InChIKey | AQIHSYYVSXGRME-XZAKFNHXSA-N |
| XLogP | 3.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |