C19H23F3O7S — CID 138563740
[5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (R)-4-(trifluoromethyl)benzenesulfinate (PubChem CID 138563740) has the molecular formula C19H23F3O7S and a molecular weight of 452.45 g/mol. Its IUPAC name is [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (R)-4-(trifluoromethyl)benzenesulfinate.
| Compound Name | [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (R)-4-(trifluoromethyl)benzenesulfinate |
|---|---|
| PubChem CID | 138563740 |
| Molecular Formula | C19H23F3O7S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (R)-4-(trifluoromethyl)benzenesulfinate |
| SMILES | CC1(C)OC2OC([C@H]3COC(C)(C)O3)C(O[S@@](=O)c3ccc(C(F)(F)F)cc3)C2O1 |
| InChI | InChI=1S/C19H23F3O7S/c1-17(2)24-9-12(26-17)13-14(15-16(25-13)28-18(3,4)27-15)29-30(23)11-7-5-10(6-8-11)19(20,21)22/h5-8,12-16H,9H2,1-4H3/t12-,13?,14?,15?,16?,30-/m1/s1 |
| InChIKey | CSYNCZAJYCOJHK-ZPVHDDNESA-N |
| XLogP | 3.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |