C23H35FN2O — CID 138563998
(3Z)-4-fluoro-N,6-dimethyl-7-[2-methyl-4-methylidene-5-[2-(propoxymethyl)prop-2-enyl]-2,3-dihydro-1H-pyridin-3-yl]hepta-1,3,6-trien-3-amine (PubChem CID 138563998) has the molecular formula C23H35FN2O and a molecular weight of 374.54 g/mol. Its IUPAC name is (3Z)-4-fluoro-N,6-dimethyl-7-[2-methyl-4-methylidene-5-[2-(propoxymethyl)prop-2-enyl]-2,3-dihydro-1H-pyridin-3-yl]hepta-1,3,6-trien-3-amine.
| Compound Name | (3Z)-4-fluoro-N,6-dimethyl-7-[2-methyl-4-methylidene-5-[2-(propoxymethyl)prop-2-enyl]-2,3-dihydro-1H-pyridin-3-yl]hepta-1,3,6-trien-3-amine |
|---|---|
| PubChem CID | 138563998 |
| Molecular Formula | C23H35FN2O |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (3Z)-4-fluoro-N,6-dimethyl-7-[2-methyl-4-methylidene-5-[2-(propoxymethyl)prop-2-enyl]-2,3-dihydro-1H-pyridin-3-yl]hepta-1,3,6-trien-3-amine |
| SMILES | C=C/C(NC)=C(/F)CC(C)=CC1C(=C)C(CC(=C)COCCC)=CNC1C |
| InChI | InChI=1S/C23H35FN2O/c1-8-10-27-15-17(4)11-20-14-26-19(6)21(18(20)5)12-16(3)13-22(24)23(9-2)25-7/h9,12,14,19,21,25-26H,2,4-5,8,10-11,13,15H2,1,3,6-7H3/b16-12?,23-22- |
| InChIKey | AVOVQMQAZHJWMG-XDDIDGEOSA-N |
| XLogP | 5.33 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|