C57H64F8O11S3 — CID 138564362
dioctyl 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methyl-6-octoxysulfonylnaphthalen-1-yl)oxyphenyl]phenoxy]naphthalene-2,7-disulfonate (PubChem CID 138564362) has the molecular formula C57H64F8O11S3 and a molecular weight of 1173.31 g/mol. Its IUPAC name is dioctyl 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methyl-6-octoxysulfonylnaphthalen-1-yl)oxyphenyl]phenoxy]naphthalene-2,7-disulfonate.
| Compound Name | dioctyl 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methyl-6-octoxysulfonylnaphthalen-1-yl)oxyphenyl]phenoxy]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 138564362 |
| Molecular Formula | C57H64F8O11S3 |
| Molecular Weight | 1173.31 g/mol |
| Exact Mass | 1172.35 |
| IUPAC Name | dioctyl 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-methyl-6-octoxysulfonylnaphthalen-1-yl)oxyphenyl]phenoxy]naphthalene-2,7-disulfonate |
| SMILES | CCCCCCCCOS(=O)(=O)c1ccc2c(Oc3c(F)c(F)c(-c4c(F)c(F)c(Oc5cc(S(=O)(=O)OCCCCCCCC)cc6cc(S(=O)(=O)OCCCCCCCC)ccc56)c(F)c4F)c(F)c3F)cc(C)cc2c1 |
| InChI | InChI=1S/C57H64F8O11S3/c1-5-8-11-14-17-20-27-72-77(66,67)39-23-25-42-37(32-39)30-36(4)31-44(42)75-56-52(62)48(58)46(49(59)53(56)63)47-50(60)54(64)57(55(65)51(47)61)76-45-35-41(79(70,71)74-29-22-19-16-13-10-7-3)34-38-33-40(24-26-43(38)45)78(68,69)73-28-21-18-15-12-9-6-2/h23-26,30-35H,5-22,27-29H2,1-4H3 |
| InChIKey | REZQBLCLNCGJDF-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.31 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|