C17H29F3N2 — CID 138564568
N',N'-diethyl-N-methyl-N-[(3Z,5Z)-5-methyl-7-(trifluoromethyl)octa-3,5,7-trienyl]ethane-1,2-diamine (PubChem CID 138564568) has the molecular formula C17H29F3N2 and a molecular weight of 318.43 g/mol. Its IUPAC name is N',N'-diethyl-N-methyl-N-[(3Z,5Z)-5-methyl-7-(trifluoromethyl)octa-3,5,7-trienyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-methyl-N-[(3Z,5Z)-5-methyl-7-(trifluoromethyl)octa-3,5,7-trienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 138564568 |
| Molecular Formula | C17H29F3N2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N',N'-diethyl-N-methyl-N-[(3Z,5Z)-5-methyl-7-(trifluoromethyl)octa-3,5,7-trienyl]ethane-1,2-diamine |
| SMILES | C=C(/C=C(C)\C=C/CCN(C)CCN(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C17H29F3N2/c1-6-22(7-2)13-12-21(5)11-9-8-10-15(3)14-16(4)17(18,19)20/h8,10,14H,4,6-7,9,11-13H2,1-3,5H3/b10-8-,15-14- |
| InChIKey | USNLXQDNOFIMRH-VRFDNOBASA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|