C23H32N2 — CID 138565172
(4E,6E)-6-(3,5-dimethyl-2H-pyrrol-4-yl)-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methylideneocta-4,6-dien-4-amine (PubChem CID 138565172) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is (4E,6E)-6-(3,5-dimethyl-2H-pyrrol-4-yl)-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methylideneocta-4,6-dien-4-amine.
| Compound Name | (4E,6E)-6-(3,5-dimethyl-2H-pyrrol-4-yl)-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methylideneocta-4,6-dien-4-amine |
|---|---|
| PubChem CID | 138565172 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | (4E,6E)-6-(3,5-dimethyl-2H-pyrrol-4-yl)-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methylideneocta-4,6-dien-4-amine |
| SMILES | C=C/C=C\C(=C/C)CN/C(=C/C(=C\C)C1=C(C)CN=C1C)C(=C)CC |
| InChI | InChI=1S/C23H32N2/c1-8-12-13-20(10-3)16-25-22(17(5)9-2)14-21(11-4)23-18(6)15-24-19(23)7/h8,10-14,25H,1,5,9,15-16H2,2-4,6-7H3/b13-12-,20-10+,21-11+,22-14+ |
| InChIKey | TZQZUAMJRMXYJF-SMDDGNDZSA-N |
| XLogP | 5.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|