C23H15F2N3OS2 — CID 138566303
5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-1,3-dihydroindol-2-one (PubChem CID 138566303) has the molecular formula C23H15F2N3OS2 and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 138566303 |
| Molecular Formula | C23H15F2N3OS2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 5-[5-[5-[(2,4-difluorophenyl)sulfanylamino]-3-pyridinyl]thiophen-2-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3ccc(-c4cncc(NSc5ccc(F)cc5F)c4)s3)ccc2N1 |
| InChI | InChI=1S/C23H15F2N3OS2/c24-16-2-4-22(18(25)10-16)31-28-17-8-15(11-26-12-17)21-6-5-20(30-21)13-1-3-19-14(7-13)9-23(29)27-19/h1-8,10-12,28H,9H2,(H,27,29) |
| InChIKey | GSVLKWYQEQJBGH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|