About 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide
5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide (PubChem CID 138566570) has the molecular formula C17H13N3O3S2
and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide |
| PubChem CID | 138566570 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(-c2ccc(-c3ccc4c(c3)CNC4=O)s2)c1 |
| InChI | InChI=1S/C17H13N3O3S2/c18-25(22,23)13-6-12(7-19-9-13)16-4-3-15(24-16)10-1-2-14-11(5-10)8-20-17(14)21/h1-7,9H,8H2,(H,20,21)(H2,18,22,23) |
| InChIKey | WZKWBQICKFQHKD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide?
The IUPAC name of 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide (CID 138566570) is 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide.
What is the SMILES notation for 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide?
The canonical SMILES for 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide is NS(=O)(=O)c1cncc(-c2ccc(-c3ccc4c(c3)CNC4=O)s2)c1.
What is the InChIKey of 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide?
The InChIKey is WZKWBQICKFQHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3S2/c18-25(22,23)13-6-12(7-19-9-13)16-4-3-15(24-16)10-1-2-14-11(5-10)8-20-17(14)21/h1-7,9H,8H2,(H,20,21)(H2,18,22,23).
What are the key properties of 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide?
5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide has a molecular weight of 371.44 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(1-oxo-2,3-dihydroisoindol-5-yl)thiophen-2-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 138566570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).