C30H31N5OS2 — CID 138566640
2-[(dimethylamino)methyl]-4-[5-[5-[[4-(3,5-dimethyl-1,5-dihydropyrazol-2-yl)phenyl]sulfanylamino]-3-pyridinyl]thiophen-2-yl]benzaldehyde (PubChem CID 138566640) has the molecular formula C30H31N5OS2 and a molecular weight of 541.75 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-4-[5-[5-[[4-(3,5-dimethyl-1,5-dihydropyrazol-2-yl)phenyl]sulfanylamino]-3-pyridinyl]thiophen-2-yl]benzaldehyde.
| Compound Name | 2-[(dimethylamino)methyl]-4-[5-[5-[[4-(3,5-dimethyl-1,5-dihydropyrazol-2-yl)phenyl]sulfanylamino]-3-pyridinyl]thiophen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 138566640 |
| Molecular Formula | C30H31N5OS2 |
| Molecular Weight | 541.75 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-[(dimethylamino)methyl]-4-[5-[5-[[4-(3,5-dimethyl-1,5-dihydropyrazol-2-yl)phenyl]sulfanylamino]-3-pyridinyl]thiophen-2-yl]benzaldehyde |
| SMILES | CC1=CC(C)NN1c1ccc(SNc2cncc(-c3ccc(-c4ccc(C=O)c(CN(C)C)c4)s3)c2)cc1 |
| InChI | InChI=1S/C30H31N5OS2/c1-20-13-21(2)35(32-20)27-7-9-28(10-8-27)38-33-26-15-24(16-31-17-26)30-12-11-29(37-30)22-5-6-23(19-36)25(14-22)18-34(3)4/h5-17,19-20,32-33H,18H2,1-4H3 |
| InChIKey | IBAQKNGGVLQNLA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|