C19H27NO7 — CID 138566953
2-[[3-(3-ethylphenoxy)-2-(1-hydroxyprop-2-enoxy)propoxy]carbonylamino]ethyl acetate (PubChem CID 138566953) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[[3-(3-ethylphenoxy)-2-(1-hydroxyprop-2-enoxy)propoxy]carbonylamino]ethyl acetate.
| Compound Name | 2-[[3-(3-ethylphenoxy)-2-(1-hydroxyprop-2-enoxy)propoxy]carbonylamino]ethyl acetate |
|---|---|
| PubChem CID | 138566953 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[[3-(3-ethylphenoxy)-2-(1-hydroxyprop-2-enoxy)propoxy]carbonylamino]ethyl acetate |
| SMILES | C=CC(O)OC(COC(=O)NCCOC(C)=O)COc1cccc(CC)c1 |
| InChI | InChI=1S/C19H27NO7/c1-4-15-7-6-8-16(11-15)25-12-17(27-18(22)5-2)13-26-19(23)20-9-10-24-14(3)21/h5-8,11,17-18,22H,2,4,9-10,12-13H2,1,3H3,(H,20,23) |
| InChIKey | OYNSZWIESPNTGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|