C13H10Cl4O2 — CID 138566997
1,2,3,4-tetrachloro-6,8-dimethyl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione (PubChem CID 138566997) has the molecular formula C13H10Cl4O2 and a molecular weight of 340.03 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-6,8-dimethyl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione.
| Compound Name | 1,2,3,4-tetrachloro-6,8-dimethyl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione |
|---|---|
| PubChem CID | 138566997 |
| Molecular Formula | C13H10Cl4O2 |
| Molecular Weight | 340.03 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 1,2,3,4-tetrachloro-6,8-dimethyl-7,8-dihydro-6H-benzo[7]annulene-5,9-dione |
| SMILES | CC1CC(C)C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C13H10Cl4O2/c1-4-3-5(2)13(19)7-6(12(4)18)8(14)10(16)11(17)9(7)15/h4-5H,3H2,1-2H3 |
| InChIKey | RBUCRLQYTQZMKB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|