About bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate
bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate (PubChem CID 138567114) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate |
| PubChem CID | 138567114 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate |
| SMILES | C=CCOC(=O)/C(O)=C(\CC)C(=O)OCC=C |
| InChI | InChI=1S/C12H16O5/c1-4-7-16-11(14)9(6-3)10(13)12(15)17-8-5-2/h4-5,13H,1-2,6-8H2,3H3/b10-9- |
| InChIKey | PPMKUTOMZOISHC-KTKRTIGZSA-N |
| XLogP | 1.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate?
The IUPAC name of bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate (CID 138567114) is bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate.
What is the SMILES notation for bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate?
The canonical SMILES for bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate is C=CCOC(=O)/C(O)=C(\CC)C(=O)OCC=C.
What is the InChIKey of bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate?
The InChIKey is PPMKUTOMZOISHC-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H16O5/c1-4-7-16-11(14)9(6-3)10(13)12(15)17-8-5-2/h4-5,13H,1-2,6-8H2,3H3/b10-9-.
What are the key properties of bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate?
bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate has a molecular weight of 240.25 g/mol, XLogP of 1.67, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) (Z)-2-ethyl-3-hydroxybut-2-enedioate is sourced from PubChem (CID 138567114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).