About 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol
4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol (PubChem CID 138567264) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol |
| PubChem CID | 138567264 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol |
| SMILES | [H]/N=C/c1c(-c2c(C)noc2C)c(-c2ccc(O)cc2)nn1C |
| InChI | InChI=1S/C16H16N4O2/c1-9-14(10(2)22-19-9)15-13(8-17)20(3)18-16(15)11-4-6-12(21)7-5-11/h4-8,17,21H,1-3H3/b17-8+ |
| InChIKey | OETBXLKSUGEKAL-CAOOACKPSA-N |
| XLogP | 3.06 |
| TPSA | 87.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol?
The IUPAC name of 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol (CID 138567264) is 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol.
What is the SMILES notation for 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol?
The canonical SMILES for 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol is [H]/N=C/c1c(-c2c(C)noc2C)c(-c2ccc(O)cc2)nn1C.
What is the InChIKey of 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol?
The InChIKey is OETBXLKSUGEKAL-CAOOACKPSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-9-14(10(2)22-19-9)15-13(8-17)20(3)18-16(15)11-4-6-12(21)7-5-11/h4-8,17,21H,1-3H3/b17-8+.
What are the key properties of 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol?
4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol has a molecular weight of 296.33 g/mol, XLogP of 3.06, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methanimidoyl-1-methylpyrazol-3-yl]phenol is sourced from PubChem (CID 138567264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).